About N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine
N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 164754290) has the molecular formula C7H19AlN2O
and a molecular weight of 174.22 g/mol. Its IUPAC name is N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine |
| PubChem CID | 164754290 |
| Molecular Formula | C7H19AlN2O |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)CCO[AlH2] |
| InChI | InChI=1S/C7H17N2O.Al.2H/c1-8(2)4-5-9(3)6-7-10;;;/h4-7H2,1-3H3;;;/q-1;+1;; |
| InChIKey | OPWSTYNMHATFSO-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
The IUPAC name of N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine (CID 164754290) is N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine.
What is the SMILES notation for N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
The canonical SMILES for N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine is CN(C)CCN(C)CCO[AlH2].
What is the InChIKey of N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
The InChIKey is OPWSTYNMHATFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N2O.Al.2H/c1-8(2)4-5-9(3)6-7-10;;;/h4-7H2,1-3H3;;;/q-1;+1;;.
What are the key properties of N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine has a molecular weight of 174.22 g/mol, XLogP of -0.96, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-alumanyloxyethyl)-N,N,N'-trimethylethane-1,2-diamine is sourced from PubChem (CID 164754290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).