C48H36N2O6S2 — CID 164759096
CID 164759096 (PubChem CID 164759096) has the molecular formula C48H36N2O6S2 and a molecular weight of 800.96 g/mol.
| Compound Name | CID 164759096 |
|---|---|
| PubChem CID | 164759096 |
| Molecular Formula | C48H36N2O6S2 |
| Molecular Weight | 800.96 g/mol |
| Exact Mass | 800.20 |
| IUPAC Name | — |
| SMILES | O=C1C(=O)c2ccccc2/C1=C/c1nc2c(s1)C1=CC3C=C4OC5(CCCCC5)c5nc(/C=C6\C(=O)C(=O)c7ccccc76)sc5C4=CC3C=C1OC21CCCCC1 |
| InChI | InChI=1S/C48H36N2O6S2/c51-39-29-13-5-3-11-27(29)31(41(39)53)23-37-49-45-43(57-37)33-19-26-22-36-34(20-25(26)21-35(33)55-47(45)15-7-1-8-16-47)44-46(48(56-36)17-9-2-10-18-48)50-38(58-44)24-32-28-12-4-6-14-30(28)40(52)42(32)54/h3-6,11-14,19-26H,1-2,7-10,15-18H2/b31-23-,32-24- |
| InChIKey | XDAPLUNJTTUREE-PUHRYQSPSA-N |
| XLogP | 10.09 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.96 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|