C22H34ClN5O5Si — CID 164780496
tert-butyl N-[3-[[2-chloro-5-nitro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate (PubChem CID 164780496) has the molecular formula C22H34ClN5O5Si and a molecular weight of 512.08 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-chloro-5-nitro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-chloro-5-nitro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 164780496 |
| Molecular Formula | C22H34ClN5O5Si |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | tert-butyl N-[3-[[2-chloro-5-nitro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Nc2c([N+](=O)[O-])cnc3c2cc(Cl)n3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C22H34ClN5O5Si/c1-22(2,3)33-21(29)26-15-9-14(10-15)25-19-16-11-18(23)27(13-32-7-8-34(4,5)6)20(16)24-12-17(19)28(30)31/h11-12,14-15H,7-10,13H2,1-6H3,(H,24,25)(H,26,29) |
| InChIKey | MQWNUYZPTOBYBC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|