C23H33ClN4O6S — CID 166929283
tert-butyl 3-[2-chloro-5-nitro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridine-4-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 166929283) has the molecular formula C23H33ClN4O6S and a molecular weight of 529.06 g/mol. Its IUPAC name is tert-butyl 3-[2-chloro-5-nitro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridine-4-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-chloro-5-nitro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridine-4-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166929283 |
| Molecular Formula | C23H33ClN4O6S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | tert-butyl 3-[2-chloro-5-nitro-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-b]pyridine-4-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)c2c([N+](=O)[O-])cnc3c2cc(Cl)n3COCCS(C)(C)C)C1 |
| InChI | InChI=1S/C23H33ClN4O6S/c1-23(2,3)34-22(30)26-8-7-15(13-26)20(29)19-16-11-18(24)27(14-33-9-10-35(4,5)6)21(16)25-12-17(19)28(31)32/h11-12,15H,7-10,13-14H2,1-6H3 |
| InChIKey | RQICCIXEIMYCSN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|