C13H16BrCl2N3O3Si — CID 162432458
2-[(3-bromo-2,4-dichloro-5-nitropyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 162432458) has the molecular formula C13H16BrCl2N3O3Si and a molecular weight of 441.19 g/mol. Its IUPAC name is 2-[(3-bromo-2,4-dichloro-5-nitropyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(3-bromo-2,4-dichloro-5-nitropyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 162432458 |
| Molecular Formula | C13H16BrCl2N3O3Si |
| Molecular Weight | 441.19 g/mol |
| Exact Mass | 438.95 |
| IUPAC Name | 2-[(3-bromo-2,4-dichloro-5-nitropyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)c(Br)c2c(Cl)c([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C13H16BrCl2N3O3Si/c1-23(2,3)5-4-22-7-18-12(16)10(14)9-11(15)8(19(20)21)6-17-13(9)18/h6H,4-5,7H2,1-3H3 |
| InChIKey | YZEDYOMGGMJDLF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.19 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|