C15H21ClIN4O3Si- — CID 163714937
CID 163714937 (PubChem CID 163714937) has the molecular formula C15H21ClIN4O3Si- and a molecular weight of 495.80 g/mol.
| Compound Name | CID 163714937 |
|---|---|
| PubChem CID | 163714937 |
| Molecular Formula | C15H21ClIN4O3Si- |
| Molecular Weight | 495.80 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | — |
| SMILES | CC1Nc2c([N+](=O)[O-])cnc3c2c(c(Cl)n3COCC[Si](C)(C)C)[I-]1 |
| InChI | InChI=1S/C15H21ClIN4O3Si/c1-9-17-12-11-13(19-9)10(21(22)23)7-18-15(11)20(14(12)16)8-24-5-6-25(2,3)4/h7,9,19H,5-6,8H2,1-4H3/q-1 |
| InChIKey | KZTLEYXZFBSUBD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.80 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|