C76H64B2N6O — CID 164782669
CID 164782669 (PubChem CID 164782669) has the molecular formula C76H64B2N6O and a molecular weight of 1108.07 g/mol.
| Compound Name | CID 164782669 |
|---|---|
| PubChem CID | 164782669 |
| Molecular Formula | C76H64B2N6O |
| Molecular Weight | 1108.07 g/mol |
| Exact Mass | 1107.59 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(Oc3ccc4c5c([2H])c([2H])c([2H])c([2H])c5n(-c5cc(C(C)(c6ccccc6)c6ccccc6)ccn5)c4c3)cc(N3CN(c4c(/C5=C/C=C\N/C=C\C=C/[B]5)cc(C(C)(C)C)cc4/C4=C/C=C\N/C=C\C=C/[B]4)c4ccccc43)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C76H64B2N6O/c1-75(2,3)59-48-65(67-31-22-43-79-41-20-18-39-77-67)74(66(49-59)68-32-23-44-80-42-21-19-40-78-68)83-53-82(70-34-16-17-35-71(70)83)60-46-55(54-24-8-5-9-25-54)47-62(51-60)85-61-36-37-64-63-30-14-15-33-69(63)84(72(64)52-61)73-50-58(38-45-81-73)76(4,56-26-10-6-11-27-56)57-28-12-7-13-29-57/h5-52,79-80H,53H2,1-4H3/b39-18-,40-19-,41-20-,42-21-,43-22-,44-23-,67-31-,68-32-/i5D,8D,9D,14D,15D,24D,25D,30D,33D |
| InChIKey | IGDMDFRQWGGVHP-QNFOTHIESA-N |
| XLogP | 17.92 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.07 |
| LogP ≤ 5 | 17.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|