C84H80B2N6O — CID 164782749
CID 164782749 (PubChem CID 164782749) has the molecular formula C84H80B2N6O and a molecular weight of 1215.25 g/mol.
| Compound Name | CID 164782749 |
|---|---|
| PubChem CID | 164782749 |
| Molecular Formula | C84H80B2N6O |
| Molecular Weight | 1215.25 g/mol |
| Exact Mass | 1214.68 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1ccc(Oc3cc(-c4c(C(C)(C)C)cccc4C(C)(C)C)cc(N4CN(c5c(/C6=C/C=C\N/C=C\C=C/[B]6)cc(C(C)(C)C)cc5/C5=C/C=C\N/C=C\C=C/[B]5)c5ccccc54)c3)cc1n2-c1cc(C(C)(c2ccccc2)c2ccccc2)ccn1 |
| InChI | InChI=1S/C84H80B2N6O/c1-81(2,3)62-52-68(72-35-26-47-87-45-23-21-43-85-72)80(69(53-62)73-36-27-48-88-46-24-22-44-86-73)91-57-90(75-38-19-20-39-76(75)91)63-50-58(79-70(82(4,5)6)33-25-34-71(79)83(7,8)9)51-65(55-63)93-64-40-41-67-66-32-17-18-37-74(66)92(77(67)56-64)78-54-61(42-49-89-78)84(10,59-28-13-11-14-29-59)60-30-15-12-16-31-60/h11-56,87-88H,57H2,1-10H3/b43-21-,44-22-,45-23-,46-24-,47-26-,48-27-,72-35-,73-36-/i17D,18D,32D,37D |
| InChIKey | MLVVVGYOGRYWEG-CYSZIEDTSA-N |
| XLogP | 20.51 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1215.25 |
| LogP ≤ 5 | 20.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|