C69H67B2N7O — CID 164782786
CID 164782786 (PubChem CID 164782786) has the molecular formula C69H67B2N7O and a molecular weight of 1031.97 g/mol.
| Compound Name | CID 164782786 |
|---|---|
| PubChem CID | 164782786 |
| Molecular Formula | C69H67B2N7O |
| Molecular Weight | 1031.97 g/mol |
| Exact Mass | 1031.56 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccc(C(C)(C)C)cc3c3ccc(Oc4cc(N5CN(c6c(/C7=C/C=C\N/C=C\C=C/[B]7)cc(C(C)(C)C)cc6/C6=C/C=C\N/C=C\C=C/[B]6)c6ccccc65)cc(-c5ccccc5)n4)cc32)c1 |
| InChI | InChI=1S/C69H67B2N7O/c1-67(2,3)48-27-30-60-54(39-48)53-29-28-52(45-63(53)78(60)64-42-49(31-38-74-64)68(4,5)6)79-65-44-51(43-59(75-65)47-21-11-10-12-22-47)76-46-77(62-26-14-13-25-61(62)76)66-55(57-23-19-36-72-34-17-15-32-70-57)40-50(69(7,8)9)41-56(66)58-24-20-37-73-35-18-16-33-71-58/h10-45,72-73H,46H2,1-9H3/b32-15-,33-16-,34-17-,35-18-,36-19-,37-20-,57-23-,58-24- |
| InChIKey | SLQQYPWYCDCXQR-JMRIRWLESA-N |
| XLogP | 16.55 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.97 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|