C60H48B2N8O — CID 164782707
CID 164782707 (PubChem CID 164782707) has the molecular formula C60H48B2N8O and a molecular weight of 925.77 g/mol.
| Compound Name | CID 164782707 |
|---|---|
| PubChem CID | 164782707 |
| Molecular Formula | C60H48B2N8O |
| Molecular Weight | 925.77 g/mol |
| Exact Mass | 925.46 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1ccc(Oc3cc(N4CN(c5c(/C6=C/C=C\N/C=C\C=C/[B]6)cccc5/C5=C/C=C\N/C=C\C=C/[B]5)c5ccccc54)cc(-c4ccccc4)n3)cc1n2C1Nc2ccccc2N1C([2H])([2H])[2H] |
| InChI | InChI=1S/C60H48B2N8O/c1-67-54-27-8-6-25-51(54)66-60(67)70-53-26-7-5-20-45(53)46-31-30-44(40-57(46)70)71-58-39-43(38-52(65-58)42-18-3-2-4-19-42)68-41-69(56-29-10-9-28-55(56)68)59-47(49-23-16-36-63-34-13-11-32-61-49)21-15-22-48(59)50-24-17-37-64-35-14-12-33-62-50/h2-40,60,63-64,66H,41H2,1H3/b32-11-,33-12-,34-13-,35-14-,36-16-,37-17-,49-23-,50-24-/i1D3,5D,7D,20D,26D |
| InChIKey | BRMUONOZDYGLFY-QSWVBQSTSA-N |
| XLogP | 13.29 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.77 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|