C88H88B2N6O — CID 164782831
CID 164782831 (PubChem CID 164782831) has the molecular formula C88H88B2N6O and a molecular weight of 1267.34 g/mol.
| Compound Name | CID 164782831 |
|---|---|
| PubChem CID | 164782831 |
| Molecular Formula | C88H88B2N6O |
| Molecular Weight | 1267.34 g/mol |
| Exact Mass | 1266.72 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2cc(Oc3ccc4c5cc(C(C)(C)C)ccc5n(-c5cc(C(C)(c6ccccc6)c6ccccc6)ccn5)c4c3)cc(N3CN(c4c(/C5=C/C=C\N/C=C\C=C/[B]5)cccc4/C4=C/C=C\N/C=C\C=C/[B]4)c4ccccc43)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C88H88B2N6O/c1-84(2,3)63-39-42-77-72(53-63)69-41-40-67(58-80(69)96(77)81-56-64(43-50-93-81)88(13,61-29-16-14-17-30-61)62-31-18-15-19-32-62)97-68-52-60(82-73(86(7,8)9)54-65(85(4,5)6)55-74(82)87(10,11)12)51-66(57-68)94-59-95(79-38-21-20-37-78(79)94)83-70(75-35-27-48-91-46-24-22-44-89-75)33-26-34-71(83)76-36-28-49-92-47-25-23-45-90-76/h14-58,91-92H,59H2,1-13H3/b44-22-,45-23-,46-24-,47-25-,48-27-,49-28-,75-35-,76-36- |
| InChIKey | QJBIOAVXKXOXFC-DDSCXSEJSA-N |
| XLogP | 21.81 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1267.34 |
| LogP ≤ 5 | 21.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|