C59H55B2N7O — CID 164782761
CID 164782761 (PubChem CID 164782761) has the molecular formula C59H55B2N7O and a molecular weight of 899.76 g/mol.
| Compound Name | CID 164782761 |
|---|---|
| PubChem CID | 164782761 |
| Molecular Formula | C59H55B2N7O |
| Molecular Weight | 899.76 g/mol |
| Exact Mass | 899.47 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cc(N5CN(c6c(/C7=C/C=C\N/C=C\C=C/[B]7)cc(C(C)(C)C)cc6/C6=C/C=C\N/C=C\C=C/[B]6)c6ccccc65)ccn4)cc32)c1 |
| InChI | InChI=1S/C59H55B2N7O/c1-58(2,3)41-25-33-64-55(37-41)68-51-20-8-7-17-45(51)46-24-23-44(39-54(46)68)69-56-38-43(26-34-65-56)66-40-67(53-22-10-9-21-52(53)66)57-47(49-18-15-31-62-29-13-11-27-60-49)35-42(59(4,5)6)36-48(57)50-19-16-32-63-30-14-12-28-61-50/h7-39,62-63H,40H2,1-6H3/b27-11-,28-12-,29-13-,30-14-,31-15-,32-16-,49-18-,50-19- |
| InChIKey | JONDVJUQTMXIPO-XSWIBKJVSA-N |
| XLogP | 13.59 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.76 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|