C65H59B2N7O — CID 164782745
CID 164782745 (PubChem CID 164782745) has the molecular formula C65H59B2N7O and a molecular weight of 984.91 g/mol.
| Compound Name | CID 164782745 |
|---|---|
| PubChem CID | 164782745 |
| Molecular Formula | C65H59B2N7O |
| Molecular Weight | 984.91 g/mol |
| Exact Mass | 984.55 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(N3CN(c4c(/C5=C/C=C\N/C=C\C=C/[B]5)cc(C(C)(C)C)cc4/C4=C/C=C\N/C=C\C=C/[B]4)c4ccccc43)cc(Oc3ccc4c5c([2H])c([2H])c([2H])c([2H])c5n(-c5cc(C(C)(C)C)ccn5)c4c3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C65H59B2N7O/c1-64(2,3)46-30-37-70-61(40-46)74-57-25-11-10-22-50(57)51-29-28-49(43-60(51)74)75-62-42-48(41-56(71-62)45-20-8-7-9-21-45)72-44-73(59-27-13-12-26-58(59)72)63-52(54-23-18-35-68-33-16-14-31-66-54)38-47(65(4,5)6)39-53(63)55-24-19-36-69-34-17-15-32-67-55/h7-43,68-69H,44H2,1-6H3/b31-14-,32-15-,33-16-,34-17-,35-18-,36-19-,54-23-,55-24-/i7D,8D,9D,10D,11D,20D,21D,22D,25D |
| InChIKey | PYWVNGIJHFMHBK-OHPVWCFESA-N |
| XLogP | 15.25 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.91 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|