C20H15BrFN3O4 — CID 164842687
tert-butyl 6-bromo-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate (PubChem CID 164842687) has the molecular formula C20H15BrFN3O4 and a molecular weight of 460.26 g/mol. Its IUPAC name is tert-butyl 6-bromo-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate.
| Compound Name | tert-butyl 6-bromo-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate |
|---|---|
| PubChem CID | 164842687 |
| Molecular Formula | C20H15BrFN3O4 |
| Molecular Weight | 460.26 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | tert-butyl 6-bromo-3-(1,3-dioxoisoindol-2-yl)-7-fluoroindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(N2C(=O)c3ccccc3C2=O)c2ccc(Br)c(F)c21 |
| InChI | InChI=1S/C20H15BrFN3O4/c1-20(2,3)29-19(28)25-15-12(8-9-13(21)14(15)22)16(23-25)24-17(26)10-6-4-5-7-11(10)18(24)27/h4-9H,1-3H3 |
| InChIKey | NBBWYSZGCBESFN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|