C17H24FN3O3S — CID 164843969
[(2R,3R,4R,5R,6S)-5-azido-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol (PubChem CID 164843969) has the molecular formula C17H24FN3O3S and a molecular weight of 369.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-azido-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R,6S)-5-azido-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 164843969 |
| Molecular Formula | C17H24FN3O3S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-azido-3-butoxy-4-fluoro-6-(4-methylphenyl)sulfanyloxan-2-yl]methanol |
| SMILES | CCCCO[C@H]1[C@H](F)[C@@H](N=[N+]=[N-])[C@H](Sc2ccc(C)cc2)O[C@@H]1CO |
| InChI | InChI=1S/C17H24FN3O3S/c1-3-4-9-23-16-13(10-22)24-17(15(14(16)18)20-21-19)25-12-7-5-11(2)6-8-12/h5-8,13-17,22H,3-4,9-10H2,1-2H3/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | YIHCZYSOVHBHRT-HHARLNAUSA-N |
| XLogP | 4.01 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|