C20H37N3 — CID 164861326
N'-[2-[1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-yl]ethyl]-N,N'-dimethylbutane-1,4-diamine (PubChem CID 164861326) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is N'-[2-[1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-yl]ethyl]-N,N'-dimethylbutane-1,4-diamine.
| Compound Name | N'-[2-[1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-yl]ethyl]-N,N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 164861326 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | N'-[2-[1-[(2E)-2-ethenylpenta-2,4-dienyl]piperidin-4-yl]ethyl]-N,N'-dimethylbutane-1,4-diamine |
| SMILES | C=C/C=C(\C=C)CN1CCC(CCN(C)CCCCNC)CC1 |
| InChI | InChI=1S/C20H37N3/c1-5-9-19(6-2)18-23-16-11-20(12-17-23)10-15-22(4)14-8-7-13-21-3/h5-6,9,20-21H,1-2,7-8,10-18H2,3-4H3/b19-9+ |
| InChIKey | QJXAJGIBVBBKQI-DJKKODMXSA-N |
| XLogP | 3.32 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|