C17H12F9NO3S — CID 164862079
4-(trifluoromethoxy)-N-[4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-yl]benzenesulfonamide (PubChem CID 164862079) has the molecular formula C17H12F9NO3S and a molecular weight of 481.34 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-N-[4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-yl]benzenesulfonamide.
| Compound Name | 4-(trifluoromethoxy)-N-[4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 164862079 |
| Molecular Formula | C17H12F9NO3S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 4-(trifluoromethoxy)-N-[4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(Cc1cc(F)c(F)cc1F)CC(F)(F)F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F9NO3S/c18-13-7-15(20)14(19)6-9(13)5-10(8-16(21,22)23)27-31(28,29)12-3-1-11(2-4-12)30-17(24,25)26/h1-4,6-7,10,27H,5,8H2 |
| InChIKey | FVCKIRYLDAHZEM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|