C20H35NaO8S — CID 164886052
sodium 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonate (PubChem CID 164886052) has the molecular formula C20H35NaO8S and a molecular weight of 458.55 g/mol. Its IUPAC name is sodium 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonate.
| Compound Name | sodium 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonate |
|---|---|
| PubChem CID | 164886052 |
| Molecular Formula | C20H35NaO8S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | sodium 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonate |
| SMILES | CC(C)(C)COC(=O)C(C(=O)CC(C)(C)C)C(C(=O)OCC(C)(C)C)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H36O8S.Na/c1-18(2,3)10-13(21)14(16(22)27-11-19(4,5)6)15(29(24,25)26)17(23)28-12-20(7,8)9;/h14-15H,10-12H2,1-9H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | AHYTUNSNMPQPCF-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|