C31H25NO4 — CID 164888159
dimethyl (9R)-10-(benzhydrylideneamino)-9H-phenanthrene-9,10-dicarboxylate (PubChem CID 164888159) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is dimethyl (9R)-10-(benzhydrylideneamino)-9H-phenanthrene-9,10-dicarboxylate.
| Compound Name | dimethyl (9R)-10-(benzhydrylideneamino)-9H-phenanthrene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 164888159 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | dimethyl (9R)-10-(benzhydrylideneamino)-9H-phenanthrene-9,10-dicarboxylate |
| SMILES | COC(=O)[C@@H]1c2ccccc2-c2ccccc2C1(N=C(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C31H25NO4/c1-35-29(33)27-25-19-10-9-17-23(25)24-18-11-12-20-26(24)31(27,30(34)36-2)32-28(21-13-5-3-6-14-21)22-15-7-4-8-16-22/h3-20,27H,1-2H3/t27-,31?/m0/s1 |
| InChIKey | SRIDDFYYQQWZTQ-LMUZMDBKSA-N |
| XLogP | 5.53 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|