C12H13N5O2 — CID 164889015
2-(1,5-dioxo-2H-2,4-benzodiazepin-3-yl)-1,1-dimethylguanidine (PubChem CID 164889015) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-(1,5-dioxo-2H-2,4-benzodiazepin-3-yl)-1,1-dimethylguanidine.
| Compound Name | 2-(1,5-dioxo-2H-2,4-benzodiazepin-3-yl)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 164889015 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(1,5-dioxo-2H-2,4-benzodiazepin-3-yl)-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/c1nc(=O)c2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H13N5O2/c1-17(2)11(13)16-12-14-9(18)7-5-3-4-6-8(7)10(19)15-12/h3-6H,1-2H3,(H3,13,14,15,16,18,19) |
| InChIKey | HPVFDNDWVFFGLF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|