C52H48N4O8 — CID 164889295
3-[[2-[2-[2-[2-[2-[(3-carboxy-5-quinolin-4-ylanilino)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylamino]-5-(5,8-dihydroquinolin-4-yl)benzoic acid (PubChem CID 164889295) has the molecular formula C52H48N4O8 and a molecular weight of 856.98 g/mol. Its IUPAC name is 3-[[2-[2-[2-[2-[2-[(3-carboxy-5-quinolin-4-ylanilino)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylamino]-5-(5,8-dihydroquinolin-4-yl)benzoic acid.
| Compound Name | 3-[[2-[2-[2-[2-[2-[(3-carboxy-5-quinolin-4-ylanilino)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylamino]-5-(5,8-dihydroquinolin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 164889295 |
| Molecular Formula | C52H48N4O8 |
| Molecular Weight | 856.98 g/mol |
| Exact Mass | 856.35 |
| IUPAC Name | 3-[[2-[2-[2-[2-[2-[(3-carboxy-5-quinolin-4-ylanilino)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylamino]-5-(5,8-dihydroquinolin-4-yl)benzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccccc2OCCOCCOCCOc2ccccc2CNc2cc(C(=O)O)cc(-c3ccnc4ccccc34)c2)cc(-c2ccnc3c2CC=CC3)c1 |
| InChI | InChI=1S/C52H48N4O8/c57-51(58)39-27-37(43-17-19-53-47-13-5-3-11-45(43)47)29-41(31-39)55-33-35-9-1-7-15-49(35)63-25-23-61-21-22-62-24-26-64-50-16-8-2-10-36(50)34-56-42-30-38(28-40(32-42)52(59)60)44-18-20-54-48-14-6-4-12-46(44)48/h1-11,13,15-20,27-32,55-56H,12,14,21-26,33-34H2,(H,57,58)(H,59,60) |
| InChIKey | HMVKKXGOYRZLAI-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.98 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|