C13H18N5O5PS — CID 164934203
(1R,3R,4S,6S)-3-(6-aminopurin-9-yl)-1-[[hydroxy(methyl)phosphinothioyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-7-ol (PubChem CID 164934203) has the molecular formula C13H18N5O5PS and a molecular weight of 387.36 g/mol. Its IUPAC name is (1R,3R,4S,6S)-3-(6-aminopurin-9-yl)-1-[[hydroxy(methyl)phosphinothioyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1R,3R,4S,6S)-3-(6-aminopurin-9-yl)-1-[[hydroxy(methyl)phosphinothioyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 164934203 |
| Molecular Formula | C13H18N5O5PS |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (1R,3R,4S,6S)-3-(6-aminopurin-9-yl)-1-[[hydroxy(methyl)phosphinothioyl]oxymethyl]-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
| SMILES | C[C@@H]1O[C@H]2C(O)[C@@]1(COP(C)(O)=S)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H18N5O5PS/c1-6-13(3-21-24(2,20)25)9(19)8(22-6)12(23-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3,(H,20,25)(H2,14,15,16)/t6-,8-,9?,12+,13-,24?/m0/s1 |
| InChIKey | QAXKNTDCRNLKBL-MUNJZYSQSA-N |
| XLogP | -0.23 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|