C18H19N2O4+ — CID 164946311
2-(1H-pyrrolo[2,3-b]pyridin-7-ium-7-yl)-1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 164946311) has the molecular formula C18H19N2O4+ and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-7-ium-7-yl)-1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 2-(1H-pyrrolo[2,3-b]pyridin-7-ium-7-yl)-1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 164946311 |
| Molecular Formula | C18H19N2O4+ |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-b]pyridin-7-ium-7-yl)-1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)C[n+]2cccc3cc[nH]c32)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N2O4/c1-22-15-9-13(10-16(23-2)17(15)24-3)14(21)11-20-8-4-5-12-6-7-19-18(12)20/h4-10H,11H2,1-3H3/p+1 |
| InChIKey | RSUBMRSGLMJKHM-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|