C24H36BrCl2N3O2 — CID 164946819
N-[3-[3-[benzyl(methyl)amino]propyl-methylamino]propyl]-3-bromo-4-ethoxybenzamide;dihydrochloride (PubChem CID 164946819) has the molecular formula C24H36BrCl2N3O2 and a molecular weight of 549.38 g/mol. Its IUPAC name is N-[3-[3-[benzyl(methyl)amino]propyl-methylamino]propyl]-3-bromo-4-ethoxybenzamide;dihydrochloride.
| Compound Name | N-[3-[3-[benzyl(methyl)amino]propyl-methylamino]propyl]-3-bromo-4-ethoxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 164946819 |
| Molecular Formula | C24H36BrCl2N3O2 |
| Molecular Weight | 549.38 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | N-[3-[3-[benzyl(methyl)amino]propyl-methylamino]propyl]-3-bromo-4-ethoxybenzamide;dihydrochloride |
| SMILES | CCOc1ccc(C(=O)NCCCN(C)CCCN(C)Cc2ccccc2)cc1Br.Cl.Cl |
| InChI | InChI=1S/C24H34BrN3O2.2ClH/c1-4-30-23-13-12-21(18-22(23)25)24(29)26-14-8-15-27(2)16-9-17-28(3)19-20-10-6-5-7-11-20;;/h5-7,10-13,18H,4,8-9,14-17,19H2,1-3H3,(H,26,29);2*1H |
| InChIKey | RWBCSXKVHDXRED-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|