C47H80B8N5O14PS — CID 164947126
CID 164947126 (PubChem CID 164947126) has the molecular formula C47H80B8N5O14PS and a molecular weight of 1088.71 g/mol.
| Compound Name | CID 164947126 |
|---|---|
| PubChem CID | 164947126 |
| Molecular Formula | C47H80B8N5O14PS |
| Molecular Weight | 1088.71 g/mol |
| Exact Mass | 1089.59 |
| IUPAC Name | — |
| SMILES | C.[B]B=S(=B[B])(B([B])[B])C(=O)CNC(=O)C(CC(=O)CNC(=O)C(CCC(=O)NCC(=O)CC(CC(C)C)C(=O)NCC(=O)P([B])C)CC(=O)CCC(CCC(=O)CCOCC)C(=O)NCCOCCOC)CC(C)C |
| InChI | InChI=1S/C46H76B8N5O14PS.CH4/c1-8-72-17-15-36(60)12-9-32(43(67)55-16-18-73-20-19-71-6)10-13-37(61)23-33(11-14-40(64)56-26-38(62)24-34(21-30(2)3)45(69)58-28-41(65)74(7)51)44(68)57-27-39(63)25-35(22-31(4)5)46(70)59-29-42(66)75(52-47,53-48)54(49)50;/h30-35H,8-29H2,1-7H3,(H,55,67)(H,56,64)(H,57,68)(H,58,69)(H,59,70);1H4 |
| InChIKey | CNUGJHXUNHXPET-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 275.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.71 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|