C46H73B8N6O14PS — CID 165090885
CID 165090885 (PubChem CID 165090885) has the molecular formula C46H73B8N6O14PS and a molecular weight of 1083.65 g/mol.
| Compound Name | CID 165090885 |
|---|---|
| PubChem CID | 165090885 |
| Molecular Formula | C46H73B8N6O14PS |
| Molecular Weight | 1083.65 g/mol |
| Exact Mass | 1084.54 |
| IUPAC Name | — |
| SMILES | [B]B=S(=B[B])(B([B])[B])C(=O)CNC(=O)C(CC(=O)CNC(=O)C(CCC(=O)NCC(=O)CC(CC(C)C)C(=O)NCC(=O)P([B])C)CC(=O)CCC(CC(=O)CNC(=O)C(CC(=O)CN)CC(C)C)C(=O)O)CC(C)C |
| InChI | InChI=1S/C46H73B8N6O14PS/c1-26(2)12-31(17-35(62)20-55)43(70)58-22-36(63)16-30(46(73)74)8-10-34(61)15-29(9-11-39(66)56-21-37(64)18-32(13-27(3)4)44(71)59-24-40(67)75(7)51)42(69)57-23-38(65)19-33(14-28(5)6)45(72)60-25-41(68)76(52-47,53-48)54(49)50/h26-33H,8-25,55H2,1-7H3,(H,56,66)(H,57,69)(H,58,70)(H,59,71)(H,60,72)(H,73,74) |
| InChIKey | ZZQZGBIBWWACNJ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 328.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.65 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|