C41H36BrN7O3 — CID 164957333
5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 164957333) has the molecular formula C41H36BrN7O3 and a molecular weight of 754.69 g/mol. Its IUPAC name is 5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 164957333 |
| Molecular Formula | C41H36BrN7O3 |
| Molecular Weight | 754.69 g/mol |
| Exact Mass | 753.21 |
| IUPAC Name | 5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[4-[3-[(4-methoxyphenyl)methyl]-5-methyltriazol-4-yl]phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | COc1ccc(Cn2nnc(C)c2-c2ccc(-n3c(=O)c4c(n5ncc(Cc6ccccc6)c35)CN(C(=O)c3ccc(Br)c(C)c3)CC4)cc2)cc1 |
| InChI | InChI=1S/C41H36BrN7O3/c1-26-21-31(13-18-36(26)42)40(50)46-20-19-35-37(25-46)49-39(32(23-43-49)22-28-7-5-4-6-8-28)48(41(35)51)33-14-11-30(12-15-33)38-27(2)44-45-47(38)24-29-9-16-34(52-3)17-10-29/h4-18,21,23H,19-20,22,24-25H2,1-3H3 |
| InChIKey | HTWGNZQPZYDLSJ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |