C32H18N4O6 — CID 164963519
4,18-dinitro-11-(N-phenylanilino)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione (PubChem CID 164963519) has the molecular formula C32H18N4O6 and a molecular weight of 554.52 g/mol. Its IUPAC name is 4,18-dinitro-11-(N-phenylanilino)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione.
| Compound Name | 4,18-dinitro-11-(N-phenylanilino)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
|---|---|
| PubChem CID | 164963519 |
| Molecular Formula | C32H18N4O6 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 4,18-dinitro-11-(N-phenylanilino)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
| SMILES | O=c1c2ccc([N+](=O)[O-])cc2n2c3cc([N+](=O)[O-])ccc3c(=O)c3cc(N(c4ccccc4)c4ccccc4)cc1c32 |
| InChI | InChI=1S/C32H18N4O6/c37-31-24-13-11-21(35(39)40)17-28(24)34-29-18-22(36(41)42)12-14-25(29)32(38)27-16-23(15-26(31)30(27)34)33(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18H |
| InChIKey | DDNBRFJENIHNAA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 128.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|