C17H14O3 — CID 164978173
2-[(2S)-2-acetylpent-4-ynyl]naphthalene-1,4-dione (PubChem CID 164978173) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(2S)-2-acetylpent-4-ynyl]naphthalene-1,4-dione.
| Compound Name | 2-[(2S)-2-acetylpent-4-ynyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 164978173 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[(2S)-2-acetylpent-4-ynyl]naphthalene-1,4-dione |
| SMILES | C#CC[C@@H](CC1=CC(=O)c2ccccc2C1=O)C(C)=O |
| InChI | InChI=1S/C17H14O3/c1-3-6-12(11(2)18)9-13-10-16(19)14-7-4-5-8-15(14)17(13)20/h1,4-5,7-8,10,12H,6,9H2,2H3/t12-/m0/s1 |
| InChIKey | YPDZOUBESPPOKE-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|