C8H22N2O4S2 — CID 164997769
methane;N-methylacetamide;N-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)methanesulfonamide (PubChem CID 164997769) has the molecular formula C8H22N2O4S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is methane;N-methylacetamide;N-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)methanesulfonamide.
| Compound Name | methane;N-methylacetamide;N-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)methanesulfonamide |
|---|---|
| PubChem CID | 164997769 |
| Molecular Formula | C8H22N2O4S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methane;N-methylacetamide;N-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)methanesulfonamide |
| SMILES | C.C=S(C)(=O)N(C)S(C)(=O)=O.CNC(C)=O |
| InChI | InChI=1S/C4H11NO3S2.C3H7NO.CH4/c1-5(9(2,3)6)10(4,7)8;1-3(5)4-2;/h2H2,1,3-4H3;1-2H3,(H,4,5);1H4 |
| InChIKey | HUGZDRGPNZPBLN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|