C34H26N6O2S — CID 165014780
1,4-dimethyl-5-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 165014780) has the molecular formula C34H26N6O2S and a molecular weight of 582.69 g/mol. Its IUPAC name is 1,4-dimethyl-5-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-5-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 165014780 |
| Molecular Formula | C34H26N6O2S |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 1,4-dimethyl-5-[[7-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-4-yl]imino]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=N/c1ccc(-c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2nsnc12 |
| InChI | InChI=1S/C34H26N6O2S/c1-20-5-11-24(12-6-20)40(25-13-7-21(2)8-14-25)26-15-9-23(10-16-26)27-17-18-29(32-31(27)37-43-38-32)36-30-22(3)28(19-35)33(41)39(4)34(30)42/h5-18H,1-4H3/b36-30+ |
| InChIKey | WBOKSTKZEOHUDN-FMIFUCRQSA-N |
| XLogP | 7.36 |
| TPSA | 102.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|