C17H20N6O2S — CID 165020058
4-[5-amino-2-(tert-butylamino)pyrido[4,3-d]pyrimidin-8-yl]benzenesulfonamide (PubChem CID 165020058) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 4-[5-amino-2-(tert-butylamino)pyrido[4,3-d]pyrimidin-8-yl]benzenesulfonamide.
| Compound Name | 4-[5-amino-2-(tert-butylamino)pyrido[4,3-d]pyrimidin-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 165020058 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-[5-amino-2-(tert-butylamino)pyrido[4,3-d]pyrimidin-8-yl]benzenesulfonamide |
| SMILES | CC(C)(C)Nc1ncc2c(N)ncc(-c3ccc(S(N)(=O)=O)cc3)c2n1 |
| InChI | InChI=1S/C17H20N6O2S/c1-17(2,3)23-16-21-9-13-14(22-16)12(8-20-15(13)18)10-4-6-11(7-5-10)26(19,24)25/h4-9H,1-3H3,(H2,18,20)(H2,19,24,25)(H,21,22,23) |
| InChIKey | LAIFEDBPJUTYKY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |