C21H18N2OS3 — CID 165030441
2-[[10-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-methylamino]ethanol (PubChem CID 165030441) has the molecular formula C21H18N2OS3 and a molecular weight of 410.59 g/mol. Its IUPAC name is 2-[[10-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-methylamino]ethanol.
| Compound Name | 2-[[10-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 165030441 |
| Molecular Formula | C21H18N2OS3 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-[[10-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-methylamino]ethanol |
| SMILES | [C-]#[N+]/C(=C\c1cc2sc3cc(N(C)CCO)sc3c2s1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H18N2OS3/c1-13-4-6-14(7-5-13)16(22-2)10-15-11-17-20(25-15)21-18(26-17)12-19(27-21)23(3)8-9-24/h4-7,10-12,24H,8-9H2,1,3H3/b16-10- |
| InChIKey | ZGUFTSAFRXJHNR-YBEGLDIGSA-N |
| XLogP | 6.33 |
| TPSA | 27.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|