C21H20N2OS — CID 165107199
2-[[2-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-1-benzothiophen-6-yl]-methylamino]ethanol (PubChem CID 165107199) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[[2-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-1-benzothiophen-6-yl]-methylamino]ethanol.
| Compound Name | 2-[[2-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-1-benzothiophen-6-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 165107199 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[[2-[(Z)-2-isocyano-2-(4-methylphenyl)ethenyl]-1-benzothiophen-6-yl]-methylamino]ethanol |
| SMILES | [C-]#[N+]/C(=C\c1cc2ccc(N(C)CCO)cc2s1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20N2OS/c1-15-4-6-16(7-5-15)20(22-2)14-19-12-17-8-9-18(13-21(17)25-19)23(3)10-11-24/h4-9,12-14,24H,10-11H2,1,3H3/b20-14- |
| InChIKey | IMAWLGDUCQXCTI-ZHZULCJRSA-N |
| XLogP | 5.06 |
| TPSA | 27.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|