C20H28N2 — CID 165044391
1-N,1-N'-dimethyl-1-N,1-N'-diphenylhexane-1,1-diamine (PubChem CID 165044391) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-N,1-N'-dimethyl-1-N,1-N'-diphenylhexane-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethyl-1-N,1-N'-diphenylhexane-1,1-diamine |
|---|---|
| PubChem CID | 165044391 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-N,1-N'-dimethyl-1-N,1-N'-diphenylhexane-1,1-diamine |
| SMILES | CCCCCC(N(C)c1ccccc1)N(C)c1ccccc1 |
| InChI | InChI=1S/C20H28N2/c1-4-5-8-17-20(21(2)18-13-9-6-10-14-18)22(3)19-15-11-7-12-16-19/h6-7,9-16,20H,4-5,8,17H2,1-3H3 |
| InChIKey | KTPIWWLTJYLVLA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|