C28H40B2N2O15PS3 — CID 165047078
CID 165047078 (PubChem CID 165047078) has the molecular formula C28H40B2N2O15PS3 and a molecular weight of 793.43 g/mol.
| Compound Name | CID 165047078 |
|---|---|
| PubChem CID | 165047078 |
| Molecular Formula | C28H40B2N2O15PS3 |
| Molecular Weight | 793.43 g/mol |
| Exact Mass | 793.15 |
| IUPAC Name | — |
| SMILES | CC1O[C@@H](C)C(OS(=O)(=O)O)[C@H](OCc2ccccc2)C1O[C@H]1OC(COS(=O)(=O)NCc2ccccc2)[C@@H](C)[C@H](P[B]B=O)C1NS(=O)(=O)O |
| InChI | InChI=1S/C28H40B2N2O15PS3/c1-17-22(16-43-50(37,38)31-14-20-10-6-4-7-11-20)45-28(23(32-49(34,35)36)27(17)48-30-29-33)46-24-18(2)44-19(3)25(47-51(39,40)41)26(24)42-15-21-12-8-5-9-13-21/h4-13,17-19,22-28,31-32,48H,14-16H2,1-3H3,(H,34,35,36)(H,39,40,41)/t17-,18?,19+,22?,23?,24?,25?,26-,27+,28-/m1/s1 |
| InChIKey | HOEQENGXZGEANO-BDNXXMEPSA-N |
| XLogP | 0.76 |
| TPSA | 239.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|