C63H96O9 — CID 165059891
(1S,4R,7R,9S,11R,14R)-9-ethenyl-6-(hydroxymethyl)-4-methoxy-9,11,14-trimethyltricyclo[5.4.3.01,5]tetradec-5-en-10-one (PubChem CID 165059891) has the molecular formula C63H96O9 and a molecular weight of 997.45 g/mol. Its IUPAC name is (1S,4R,7R,9S,11R,14R)-9-ethenyl-6-(hydroxymethyl)-4-methoxy-9,11,14-trimethyltricyclo[5.4.3.01,5]tetradec-5-en-10-one.
| Compound Name | (1S,4R,7R,9S,11R,14R)-9-ethenyl-6-(hydroxymethyl)-4-methoxy-9,11,14-trimethyltricyclo[5.4.3.01,5]tetradec-5-en-10-one |
|---|---|
| PubChem CID | 165059891 |
| Molecular Formula | C63H96O9 |
| Molecular Weight | 997.45 g/mol |
| Exact Mass | 996.71 |
| IUPAC Name | (1S,4R,7R,9S,11R,14R)-9-ethenyl-6-(hydroxymethyl)-4-methoxy-9,11,14-trimethyltricyclo[5.4.3.01,5]tetradec-5-en-10-one |
| SMILES | C=C[C@]1(C)C[C@H]2C(CO)=C3[C@H](OC)CC[C@@]3(CC[C@H]2C)[C@@H](C)C1=O.C=C[C@]1(C)C[C@H]2C(CO)=C3[C@H](OC)CC[C@@]3(CC[C@H]2C)[C@@H](C)C1=O.C=C[C@]1(C)C[C@H]2C(CO)=C3[C@H](OC)CC[C@@]3(CC[C@H]2C)[C@@H](C)C1=O |
| InChI | InChI=1S/3C21H32O3/c3*1-6-20(4)11-15-13(2)7-9-21(14(3)19(20)23)10-8-17(24-5)18(21)16(15)12-22/h3*6,13-15,17,22H,1,7-12H2,2-5H3/t3*13-,14+,15-,17-,20-,21+/m111/s1 |
| InChIKey | RAINMNHZIJYYKE-POZYORDSSA-N |
| XLogP | 11.75 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.45 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|