C25H42F8O12 — CID 165079483
1-[3-[3-[1,1-difluoro-3-[2-hydroxy-3-[2-hydroxy-3-(2-prop-2-enoxyethoxy)propoxy]propoxy]propoxy]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]-3-(2-hydroxyethoxy)propan-2-ol (PubChem CID 165079483) has the molecular formula C25H42F8O12 and a molecular weight of 686.58 g/mol. Its IUPAC name is 1-[3-[3-[1,1-difluoro-3-[2-hydroxy-3-[2-hydroxy-3-(2-prop-2-enoxyethoxy)propoxy]propoxy]propoxy]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]-3-(2-hydroxyethoxy)propan-2-ol.
| Compound Name | 1-[3-[3-[1,1-difluoro-3-[2-hydroxy-3-[2-hydroxy-3-(2-prop-2-enoxyethoxy)propoxy]propoxy]propoxy]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]-3-(2-hydroxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 165079483 |
| Molecular Formula | C25H42F8O12 |
| Molecular Weight | 686.58 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | 1-[3-[3-[1,1-difluoro-3-[2-hydroxy-3-[2-hydroxy-3-(2-prop-2-enoxyethoxy)propoxy]propoxy]propoxy]-1,1,3,3-tetrafluoropropoxy]-3,3-difluoropropoxy]-3-(2-hydroxyethoxy)propan-2-ol |
| SMILES | C=CCOCCOCC(O)COCC(O)COCCC(F)(F)OC(F)(F)CC(F)(F)OC(F)(F)CCOCC(O)COCCO |
| InChI | InChI=1S/C25H42F8O12/c1-2-6-38-10-11-42-15-21(37)17-43-16-20(36)13-40-8-4-23(28,29)45-25(32,33)18-24(30,31)44-22(26,27)3-7-39-12-19(35)14-41-9-5-34/h2,19-21,34-37H,1,3-18H2 |
| InChIKey | UWNPESRCHNPOLD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|