C16H19F3N2O2 — CID 165112667
methyl 4-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]benzoate (PubChem CID 165112667) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is methyl 4-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]benzoate.
| Compound Name | methyl 4-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]benzoate |
|---|---|
| PubChem CID | 165112667 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 4-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NNC3CC(C(F)(F)F)CCC32)cc1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-23-15(22)10-4-2-9(3-5-10)14-12-7-6-11(16(17,18)19)8-13(12)20-21-14/h2-5,11-14,20-21H,6-8H2,1H3 |
| InChIKey | DOQQRBSZMRJLTN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |