C24H29ClN4O — CID 165118775
2-chloro-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-N-(3-methyl-4-piperazin-1-ylphenyl)benzamide (PubChem CID 165118775) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is 2-chloro-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-N-(3-methyl-4-piperazin-1-ylphenyl)benzamide.
| Compound Name | 2-chloro-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-N-(3-methyl-4-piperazin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 165118775 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-chloro-4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-N-(3-methyl-4-piperazin-1-ylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(C3=CCN(C)CC3)cc2Cl)ccc1N1CCNCC1 |
| InChI | InChI=1S/C24H29ClN4O/c1-17-15-20(4-6-23(17)29-13-9-26-10-14-29)27-24(30)21-5-3-19(16-22(21)25)18-7-11-28(2)12-8-18/h3-7,15-16,26H,8-14H2,1-2H3,(H,27,30) |
| InChIKey | ZMQJAUCZKHISJL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|