C14H20O3S — CID 165123507
3,5-dimethoxy-4-(3-methylbutylsulfanyl)benzaldehyde (PubChem CID 165123507) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3,5-dimethoxy-4-(3-methylbutylsulfanyl)benzaldehyde.
| Compound Name | 3,5-dimethoxy-4-(3-methylbutylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 165123507 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3,5-dimethoxy-4-(3-methylbutylsulfanyl)benzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1SCCC(C)C |
| InChI | InChI=1S/C14H20O3S/c1-10(2)5-6-18-14-12(16-3)7-11(9-15)8-13(14)17-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | NFGDHOUGHRJZAD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|