C13H18O4S — CID 165123531
4-(4-hydroxybutylsulfanyl)-3,5-dimethoxybenzaldehyde (PubChem CID 165123531) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-(4-hydroxybutylsulfanyl)-3,5-dimethoxybenzaldehyde.
| Compound Name | 4-(4-hydroxybutylsulfanyl)-3,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 165123531 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(4-hydroxybutylsulfanyl)-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1SCCCCO |
| InChI | InChI=1S/C13H18O4S/c1-16-11-7-10(9-15)8-12(17-2)13(11)18-6-4-3-5-14/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | WRYNYOJUFZXULK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|