C22H25FN6O2 — CID 165126402
N-[[4-[2-aminoethyl-(methylideneamino)amino]-3-fluorophenyl]methyl]-11-ethyl-4-oxa-1,10-diazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-12-carboxamide (PubChem CID 165126402) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[[4-[2-aminoethyl-(methylideneamino)amino]-3-fluorophenyl]methyl]-11-ethyl-4-oxa-1,10-diazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-12-carboxamide.
| Compound Name | N-[[4-[2-aminoethyl-(methylideneamino)amino]-3-fluorophenyl]methyl]-11-ethyl-4-oxa-1,10-diazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 165126402 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[[4-[2-aminoethyl-(methylideneamino)amino]-3-fluorophenyl]methyl]-11-ethyl-4-oxa-1,10-diazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-12-carboxamide |
| SMILES | C=NN(CCN)c1ccc(CNC(=O)c2c(CC)nc3cc4c(cn23)OCC4)cc1F |
| InChI | InChI=1S/C22H25FN6O2/c1-3-17-21(28-13-19-15(6-9-31-19)11-20(28)27-17)22(30)26-12-14-4-5-18(16(23)10-14)29(25-2)8-7-24/h4-5,10-11,13H,2-3,6-9,12,24H2,1H3,(H,26,30) |
| InChIKey | UBUOMQHMNAUXOG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|