C11H20N4 — CID 165134874
(2E,4Z)-3-methyl-N'-(methylamino)-N-(methylideneamino)octa-2,4-dienimidamide (PubChem CID 165134874) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is (2E,4Z)-3-methyl-N'-(methylamino)-N-(methylideneamino)octa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-3-methyl-N'-(methylamino)-N-(methylideneamino)octa-2,4-dienimidamide |
|---|---|
| PubChem CID | 165134874 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | (2E,4Z)-3-methyl-N'-(methylamino)-N-(methylideneamino)octa-2,4-dienimidamide |
| SMILES | C=NNC(/C=C(C)/C=C\CCC)=N\NC |
| InChI | InChI=1S/C11H20N4/c1-5-6-7-8-10(2)9-11(14-12-3)15-13-4/h7-9,13H,3,5-6H2,1-2,4H3,(H,14,15)/b8-7-,10-9+ |
| InChIKey | WQSSWDUHLAKOGI-UQGDGPGGSA-N |
| XLogP | 2.03 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|