C12H23N — CID 170325764
(2Z,4E)-N,3-diethylocta-2,4-dien-2-amine (PubChem CID 170325764) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (2Z,4E)-N,3-diethylocta-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-N,3-diethylocta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 170325764 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2Z,4E)-N,3-diethylocta-2,4-dien-2-amine |
| SMILES | CCC/C=C/C(CC)=C(/C)NCC |
| InChI | InChI=1S/C12H23N/c1-5-8-9-10-12(6-2)11(4)13-7-3/h9-10,13H,5-8H2,1-4H3/b10-9+,12-11- |
| InChIKey | DATBPUFXLXFPKJ-PVHUKWJHSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|