About 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene
3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene (PubChem CID 165136328) has the molecular formula C17H27ClO
and a molecular weight of 282.85 g/mol. Its IUPAC name is 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene.
Molecular Properties
| Compound Name | 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene |
| PubChem CID | 165136328 |
| Molecular Formula | C17H27ClO |
| Molecular Weight | 282.85 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene |
| SMILES | CC1(O)CCCC(C(C)(C)C)C1.Clc1ccccc1 |
| InChI | InChI=1S/C11H22O.C6H5Cl/c1-10(2,3)9-6-5-7-11(4,12)8-9;7-6-4-2-1-3-5-6/h9,12H,5-8H2,1-4H3;1-5H |
| InChIKey | WHJNQVILOJDQJQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene?
The IUPAC name of 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene (CID 165136328) is 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene.
What is the SMILES notation for 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene?
The canonical SMILES for 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene is CC1(O)CCCC(C(C)(C)C)C1.Clc1ccccc1.
What is the InChIKey of 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene?
The InChIKey is WHJNQVILOJDQJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C6H5Cl/c1-10(2,3)9-6-5-7-11(4,12)8-9;7-6-4-2-1-3-5-6/h9,12H,5-8H2,1-4H3;1-5H.
What are the key properties of 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene?
3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene has a molecular weight of 282.85 g/mol, XLogP of 5.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-methylcyclohexan-1-ol;chlorobenzene is sourced from PubChem (CID 165136328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).