C21H21NS — CID 165168182
9-tert-butyl-8,14-dimethyl-11-thia-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene (PubChem CID 165168182) has the molecular formula C21H21NS and a molecular weight of 319.47 g/mol. Its IUPAC name is 9-tert-butyl-8,14-dimethyl-11-thia-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene.
| Compound Name | 9-tert-butyl-8,14-dimethyl-11-thia-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
|---|---|
| PubChem CID | 165168182 |
| Molecular Formula | C21H21NS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 9-tert-butyl-8,14-dimethyl-11-thia-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
| SMILES | Cc1ccc2c(n1)sc1c(C(C)(C)C)c(C)c3ccccc3c12 |
| InChI | InChI=1S/C21H21NS/c1-12-10-11-16-17-15-9-7-6-8-14(15)13(2)18(21(3,4)5)19(17)23-20(16)22-12/h6-11H,1-5H3 |
| InChIKey | VEFYUWMOUIFMEJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |