C39H69O9P — CID 165215162
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-heptadeca-9,12-dienoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 165215162) has the molecular formula C39H69O9P and a molecular weight of 712.95 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-heptadeca-9,12-dienoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-heptadeca-9,12-dienoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 165215162 |
| Molecular Formula | C39H69O9P |
| Molecular Weight | 712.95 g/mol |
| Exact Mass | 712.47 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-heptadeca-9,12-dienoxy]propan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COCCCCCCCC/C=C\C/C=C\CCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C39H69O9P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-45-35-38(36-47-49(43,44)46-34-37(41)33-40)48-39(42)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h6,8-9,11-12,14-15,17,19,21,37-38,40-41H,3-5,7,10,13,16,18,20,22-36H2,1-2H3,(H,43,44)/b8-6-,11-9-,14-12-,17-15-,21-19- |
| InChIKey | GHLBXGSQDDRHJL-NAIWZCJVSA-N |
| XLogP | 9.63 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.95 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|