C40H69O9P — CID 165231011
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 165231011) has the molecular formula C40H69O9P and a molecular weight of 724.96 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165231011 |
| Molecular Formula | C40H69O9P |
| Molecular Weight | 724.96 g/mol |
| Exact Mass | 724.47 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoxy]propan-2-yl] (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCC/C=C\C/C=C\CCC |
| InChI | InChI=1S/C40H69O9P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-46-36-39(37-48-50(44,45)47-35-38(42)34-41)49-40(43)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h5,7-8,10-11,13-14,16-18,21,23,38-39,41-42H,3-4,6,9,12,15,19-20,22,24-37H2,1-2H3,(H,44,45)/b7-5-,10-8-,13-11-,16-14-,18-17-,23-21- |
| InChIKey | ISNRUSMZUDYRMZ-IHORMSJVSA-N |
| XLogP | 9.80 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.96 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|