C17H28N2O2 — CID 165342440
tert-butyl (3R)-3-amino-3-[4-(diethylamino)phenyl]propanoate (PubChem CID 165342440) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is tert-butyl (3R)-3-amino-3-[4-(diethylamino)phenyl]propanoate.
| Compound Name | tert-butyl (3R)-3-amino-3-[4-(diethylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 165342440 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | tert-butyl (3R)-3-amino-3-[4-(diethylamino)phenyl]propanoate |
| SMILES | CCN(CC)c1ccc([C@H](N)CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-6-19(7-2)14-10-8-13(9-11-14)15(18)12-16(20)21-17(3,4)5/h8-11,15H,6-7,12,18H2,1-5H3/t15-/m1/s1 |
| InChIKey | JSBSTHIOEYFEHQ-OAHLLOKOSA-N |
| XLogP | 3.26 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|